C18H30N6O — CID 134790486
6-(azepan-4-yl)-4-(butylamino)-9-methyl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one (PubChem CID 134790486) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is 6-(azepan-4-yl)-4-(butylamino)-9-methyl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one.
| Compound Name | 6-(azepan-4-yl)-4-(butylamino)-9-methyl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 134790486 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 6-(azepan-4-yl)-4-(butylamino)-9-methyl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one |
| SMILES | CCCCNc1ncnc2c1CN(C1CCCNCC1)C(=O)CN2C |
| InChI | InChI=1S/C18H30N6O/c1-3-4-9-20-17-15-11-24(14-6-5-8-19-10-7-14)16(25)12-23(2)18(15)22-13-21-17/h13-14,19H,3-12H2,1-2H3,(H,20,21,22) |
| InChIKey | RTMGDWLNLMKUQF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|