About 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one
1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one (PubChem CID 134790599) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one |
| PubChem CID | 134790599 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one |
| SMILES | O=C1Nc2ccccc2CC12CCN(CC1CC1)CC2 |
| InChI | InChI=1S/C17H22N2O/c20-16-17(11-14-3-1-2-4-15(14)18-16)7-9-19(10-8-17)12-13-5-6-13/h1-4,13H,5-12H2,(H,18,20) |
| InChIKey | MSBQCRGGCICFIC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one?
The IUPAC name of 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one (CID 134790599) is 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one.
What is the SMILES notation for 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one?
The canonical SMILES for 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one is O=C1Nc2ccccc2CC12CCN(CC1CC1)CC2.
What is the InChIKey of 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one?
The InChIKey is MSBQCRGGCICFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c20-16-17(11-14-3-1-2-4-15(14)18-16)7-9-19(10-8-17)12-13-5-6-13/h1-4,13H,5-12H2,(H,18,20).
What are the key properties of 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one?
1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one has a molecular weight of 270.38 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(cyclopropylmethyl)spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-one is sourced from PubChem (CID 134790599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).