C17H28N6O — CID 134790849
N-cyclohexyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidine-1-carboxamide (PubChem CID 134790849) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is N-cyclohexyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 134790849 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | N-cyclohexyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C17H28N6O/c24-17(19-14-4-2-1-3-5-14)22-9-6-13(7-10-22)16-21-20-15-12-18-8-11-23(15)16/h13-14,18H,1-12H2,(H,19,24) |
| InChIKey | JLSBAMUOUBOCLI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |