About 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine]
1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine] (PubChem CID 134791368) has the molecular formula C16H22N2O3S
and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine].
Molecular Properties
| Compound Name | 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine] |
| PubChem CID | 134791368 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine] |
| SMILES | CS(=O)(=O)N1CC2(CCCN2C2COC2)Cc2ccccc21 |
| InChI | InChI=1S/C16H22N2O3S/c1-22(19,20)18-12-16(9-13-5-2-3-6-15(13)18)7-4-8-17(16)14-10-21-11-14/h2-3,5-6,14H,4,7-12H2,1H3 |
| InChIKey | BWTXOWUXUPBYOW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine]?
The IUPAC name of 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine] (CID 134791368) is 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine].
What is the SMILES notation for 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine]?
The canonical SMILES for 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine] is CS(=O)(=O)N1CC2(CCCN2C2COC2)Cc2ccccc21.
What is the InChIKey of 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine]?
The InChIKey is BWTXOWUXUPBYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3S/c1-22(19,20)18-12-16(9-13-5-2-3-6-15(13)18)7-4-8-17(16)14-10-21-11-14/h2-3,5-6,14H,4,7-12H2,1H3.
What are the key properties of 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine]?
1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine] has a molecular weight of 322.43 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,2'-pyrrolidine] is sourced from PubChem (CID 134791368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).