About benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate
benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate (PubChem CID 134791400) has the molecular formula C20H24N4O2
and a molecular weight of 352.44 g/mol. Its IUPAC name is benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate |
| PubChem CID | 134791400 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate |
| SMILES | CCCCn1c(C(C)NC(=O)OCc2ccccc2)nc2cccnc21 |
| InChI | InChI=1S/C20H24N4O2/c1-3-4-13-24-18(23-17-11-8-12-21-19(17)24)15(2)22-20(25)26-14-16-9-6-5-7-10-16/h5-12,15H,3-4,13-14H2,1-2H3,(H,22,25) |
| InChIKey | VWIHRWBVTQAWBK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate?
The IUPAC name of benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate (CID 134791400) is benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate.
What is the SMILES notation for benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate?
The canonical SMILES for benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate is CCCCn1c(C(C)NC(=O)OCc2ccccc2)nc2cccnc21.
What is the InChIKey of benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate?
The InChIKey is VWIHRWBVTQAWBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O2/c1-3-4-13-24-18(23-17-11-8-12-21-19(17)24)15(2)22-20(25)26-14-16-9-6-5-7-10-16/h5-12,15H,3-4,13-14H2,1-2H3,(H,22,25).
What are the key properties of benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate?
benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate has a molecular weight of 352.44 g/mol, XLogP of 4.22, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[1-(3-butylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate is sourced from PubChem (CID 134791400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).