C19H28N6 — CID 134791429
N,N-dimethyl-4-[(3-piperidin-4-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]aniline (PubChem CID 134791429) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[(3-piperidin-4-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[(3-piperidin-4-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]aniline |
|---|---|
| PubChem CID | 134791429 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | N,N-dimethyl-4-[(3-piperidin-4-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]aniline |
| SMILES | CN(C)c1ccc(CN2CCn3c(nnc3C3CCNCC3)C2)cc1 |
| InChI | InChI=1S/C19H28N6/c1-23(2)17-5-3-15(4-6-17)13-24-11-12-25-18(14-24)21-22-19(25)16-7-9-20-10-8-16/h3-6,16,20H,7-14H2,1-2H3 |
| InChIKey | HQOKQRXNMAWWEQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|