C18H14N4O — CID 134791858
N-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)quinoline-2-carboxamide (PubChem CID 134791858) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is N-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)quinoline-2-carboxamide.
| Compound Name | N-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 134791858 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)quinoline-2-carboxamide |
| SMILES | O=C(NCc1ccnc2[nH]ccc12)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H14N4O/c23-18(16-6-5-12-3-1-2-4-15(12)22-16)21-11-13-7-9-19-17-14(13)8-10-20-17/h1-10H,11H2,(H,19,20)(H,21,23) |
| InChIKey | QFZAXHSEDVGHRK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |