C17H15F3N4O3 — CID 134791870
N-(2-methoxyethyl)-3-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 134791870) has the molecular formula C17H15F3N4O3 and a molecular weight of 380.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 134791870 |
| Molecular Formula | C17H15F3N4O3 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-(2-methoxyethyl)-3-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | COCCNC(=O)c1ccc2nnc(-c3cccc(OC(F)(F)F)c3)n2c1 |
| InChI | InChI=1S/C17H15F3N4O3/c1-26-8-7-21-16(25)12-5-6-14-22-23-15(24(14)10-12)11-3-2-4-13(9-11)27-17(18,19)20/h2-6,9-10H,7-8H2,1H3,(H,21,25) |
| InChIKey | GUQYYSGWHCGVQI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|