About methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate
methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (PubChem CID 134792001) has the molecular formula C17H18ClN3O2
and a molecular weight of 331.80 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 134792001 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| SMILES | CCc1nc2c(c(-c3ccc(Cl)cc3)n1)CN(C(=O)OC)CC2 |
| InChI | InChI=1S/C17H18ClN3O2/c1-3-15-19-14-8-9-21(17(22)23-2)10-13(14)16(20-15)11-4-6-12(18)7-5-11/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | BCSHTMUSSHWBIT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate?
The IUPAC name of methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (CID 134792001) is methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate is CCc1nc2c(c(-c3ccc(Cl)cc3)n1)CN(C(=O)OC)CC2.
What is the InChIKey of methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate?
The InChIKey is BCSHTMUSSHWBIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3O2/c1-3-15-19-14-8-9-21(17(22)23-2)10-13(14)16(20-15)11-4-6-12(18)7-5-11/h4-7H,3,8-10H2,1-2H3.
What are the key properties of methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate?
methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate has a molecular weight of 331.80 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-chlorophenyl)-2-ethyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 134792001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).