C17H16Cl2N4OS — CID 134792404
6-(2,4-dichlorophenyl)-1-methyl-N-(2-methylsulfanylethyl)pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 134792404) has the molecular formula C17H16Cl2N4OS and a molecular weight of 395.32 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-1-methyl-N-(2-methylsulfanylethyl)pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-(2,4-dichlorophenyl)-1-methyl-N-(2-methylsulfanylethyl)pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134792404 |
| Molecular Formula | C17H16Cl2N4OS |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-1-methyl-N-(2-methylsulfanylethyl)pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CSCCNC(=O)c1cc(-c2ccc(Cl)cc2Cl)nc2c1cnn2C |
| InChI | InChI=1S/C17H16Cl2N4OS/c1-23-16-13(9-21-23)12(17(24)20-5-6-25-2)8-15(22-16)11-4-3-10(18)7-14(11)19/h3-4,7-9H,5-6H2,1-2H3,(H,20,24) |
| InChIKey | YSCFZVGMIXSQKD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|