C18H21ClN4O — CID 134792425
4-(4-chlorophenyl)-N,N,2-trimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxamide (PubChem CID 134792425) has the molecular formula C18H21ClN4O and a molecular weight of 344.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N,N,2-trimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N,N,2-trimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxamide |
|---|---|
| PubChem CID | 134792425 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-(4-chlorophenyl)-N,N,2-trimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxamide |
| SMILES | Cc1nc2c(c(-c3ccc(Cl)cc3)n1)CCN(C(=O)N(C)C)CC2 |
| InChI | InChI=1S/C18H21ClN4O/c1-12-20-16-9-11-23(18(24)22(2)3)10-8-15(16)17(21-12)13-4-6-14(19)7-5-13/h4-7H,8-11H2,1-3H3 |
| InChIKey | CZYHZEAALWTUNE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |