C16H14F2N4O3S — CID 134792786
CID 134792786 (PubChem CID 134792786) has the molecular formula C16H14F2N4O3S and a molecular weight of 380.38 g/mol.
| Compound Name | CID 134792786 |
|---|---|
| PubChem CID | 134792786 |
| Molecular Formula | C16H14F2N4O3S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])c1cccc(-c2nnc3ccc(C(=O)NCC(F)F)cn23)c1 |
| InChI | InChI=1S/C16H14F2N4O3S/c1-26(24,25)12-4-2-3-10(7-12)15-21-20-14-6-5-11(9-22(14)15)16(23)19-8-13(17)18/h2-7,9,13H,8H2,1H3,(H-,19,23,24,25) |
| InChIKey | HQEDOIWLOBRJCA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|