About 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole
5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole (PubChem CID 134792843) has the molecular formula C13H12F2N2OS
and a molecular weight of 282.31 g/mol. Its IUPAC name is 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole |
| PubChem CID | 134792843 |
| Molecular Formula | C13H12F2N2OS |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole |
| SMILES | Fc1ccc(OC2CN(Cc3cncs3)C2)cc1F |
| InChI | InChI=1S/C13H12F2N2OS/c14-12-2-1-9(3-13(12)15)18-10-5-17(6-10)7-11-4-16-8-19-11/h1-4,8,10H,5-7H2 |
| InChIKey | FRPOVLORCMRZTR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole?
The IUPAC name of 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole (CID 134792843) is 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole.
What is the SMILES notation for 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole?
The canonical SMILES for 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole is Fc1ccc(OC2CN(Cc3cncs3)C2)cc1F.
What is the InChIKey of 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole?
The InChIKey is FRPOVLORCMRZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2OS/c14-12-2-1-9(3-13(12)15)18-10-5-17(6-10)7-11-4-16-8-19-11/h1-4,8,10H,5-7H2.
What are the key properties of 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole?
5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole has a molecular weight of 282.31 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-(3,4-difluorophenoxy)azetidin-1-yl]methyl]-1,3-thiazole is sourced from PubChem (CID 134792843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).