About methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate
methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate (PubChem CID 134793217) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate.
Molecular Properties
| Compound Name | methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate |
| PubChem CID | 134793217 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate |
| SMILES | COC(=O)N1CC2(Cc3ccccc3N(C(C)=O)C2)C1 |
| InChI | InChI=1S/C15H18N2O3/c1-11(18)17-10-15(8-16(9-15)14(19)20-2)7-12-5-3-4-6-13(12)17/h3-6H,7-10H2,1-2H3 |
| InChIKey | LIGXRGDOMCZNTL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate?
The IUPAC name of methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate (CID 134793217) is methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate.
What is the SMILES notation for methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate?
The canonical SMILES for methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate is COC(=O)N1CC2(Cc3ccccc3N(C(C)=O)C2)C1.
What is the InChIKey of methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate?
The InChIKey is LIGXRGDOMCZNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-11(18)17-10-15(8-16(9-15)14(19)20-2)7-12-5-3-4-6-13(12)17/h3-6H,7-10H2,1-2H3.
What are the key properties of methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate?
methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate has a molecular weight of 274.32 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-acetylspiro[2,4-dihydroquinoline-3,3'-azetidine]-1'-carboxylate is sourced from PubChem (CID 134793217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).