About 3-butyl-1H-imidazo[4,5-b]pyridin-2-one
3-butyl-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 134794466) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-butyl-1H-imidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 3-butyl-1H-imidazo[4,5-b]pyridin-2-one |
| PubChem CID | 134794466 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-butyl-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CCCCn1c(=O)[nH]c2cccnc21 |
| InChI | InChI=1S/C10H13N3O/c1-2-3-7-13-9-8(12-10(13)14)5-4-6-11-9/h4-6H,2-3,7H2,1H3,(H,12,14) |
| InChIKey | STFXUNQZZNOPOA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-1H-imidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1H-imidazo[4,5-b]pyridin-2-one?
The IUPAC name of 3-butyl-1H-imidazo[4,5-b]pyridin-2-one (CID 134794466) is 3-butyl-1H-imidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 3-butyl-1H-imidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 3-butyl-1H-imidazo[4,5-b]pyridin-2-one is CCCCn1c(=O)[nH]c2cccnc21.
What is the InChIKey of 3-butyl-1H-imidazo[4,5-b]pyridin-2-one?
The InChIKey is STFXUNQZZNOPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-2-3-7-13-9-8(12-10(13)14)5-4-6-11-9/h4-6H,2-3,7H2,1H3,(H,12,14).
What are the key properties of 3-butyl-1H-imidazo[4,5-b]pyridin-2-one?
3-butyl-1H-imidazo[4,5-b]pyridin-2-one has a molecular weight of 191.23 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1H-imidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 134794466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).