C23H19F3N4O3S — CID 134794690
CID 134794690 (PubChem CID 134794690) has the molecular formula C23H19F3N4O3S and a molecular weight of 488.49 g/mol.
| Compound Name | CID 134794690 |
|---|---|
| PubChem CID | 134794690 |
| Molecular Formula | C23H19F3N4O3S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | — |
| SMILES | Cn1ncc2c(C(=O)NCc3cccc(C(F)(F)F)c3)cc(-c3ccc([S+](C)(=O)[O-])cc3)nc21 |
| InChI | InChI=1S/C23H19F3N4O3S/c1-30-21-19(13-28-30)18(11-20(29-21)15-6-8-17(9-7-15)34(2,32)33)22(31)27-12-14-4-3-5-16(10-14)23(24,25)26/h3-11,13H,12H2,1-2H3,(H-,27,31,32,33) |
| InChIKey | QGDUWPDYGRQKRN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|