About 2,5-dibenzyl-1,3,4-oxadiazole
2,5-dibenzyl-1,3,4-oxadiazole (PubChem CID 13479531) has the molecular formula C16H14N2O
and a molecular weight of 250.30 g/mol. Its IUPAC name is 2,5-dibenzyl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2,5-dibenzyl-1,3,4-oxadiazole |
| PubChem CID | 13479531 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2,5-dibenzyl-1,3,4-oxadiazole |
| SMILES | c1ccc(Cc2nnc(Cc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C16H14N2O/c1-3-7-13(8-4-1)11-15-17-18-16(19-15)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | DXXKXWZGEUKMKM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dibenzyl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibenzyl-1,3,4-oxadiazole?
The IUPAC name of 2,5-dibenzyl-1,3,4-oxadiazole (CID 13479531) is 2,5-dibenzyl-1,3,4-oxadiazole.
What is the SMILES notation for 2,5-dibenzyl-1,3,4-oxadiazole?
The canonical SMILES for 2,5-dibenzyl-1,3,4-oxadiazole is c1ccc(Cc2nnc(Cc3ccccc3)o2)cc1.
What is the InChIKey of 2,5-dibenzyl-1,3,4-oxadiazole?
The InChIKey is DXXKXWZGEUKMKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O/c1-3-7-13(8-4-1)11-15-17-18-16(19-15)12-14-9-5-2-6-10-14/h1-10H,11-12H2.
What are the key properties of 2,5-dibenzyl-1,3,4-oxadiazole?
2,5-dibenzyl-1,3,4-oxadiazole has a molecular weight of 250.30 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibenzyl-1,3,4-oxadiazole is sourced from PubChem (CID 13479531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).