About 3-amino-6,8-dibromo-2-methylquinazolin-4-one
3-amino-6,8-dibromo-2-methylquinazolin-4-one (PubChem CID 13479537) has the molecular formula C9H7Br2N3O
and a molecular weight of 332.98 g/mol. Its IUPAC name is 3-amino-6,8-dibromo-2-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 3-amino-6,8-dibromo-2-methylquinazolin-4-one |
| PubChem CID | 13479537 |
| Molecular Formula | C9H7Br2N3O |
| Molecular Weight | 332.98 g/mol |
| Exact Mass | 330.90 |
| IUPAC Name | 3-amino-6,8-dibromo-2-methylquinazolin-4-one |
| SMILES | Cc1nc2c(Br)cc(Br)cc2c(=O)n1N |
| InChI | InChI=1S/C9H7Br2N3O/c1-4-13-8-6(9(15)14(4)12)2-5(10)3-7(8)11/h2-3H,12H2,1H3 |
| InChIKey | UHTFEUZQHUMEIG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.98 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-6,8-dibromo-2-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,8-dibromo-2-methylquinazolin-4-one?
The IUPAC name of 3-amino-6,8-dibromo-2-methylquinazolin-4-one (CID 13479537) is 3-amino-6,8-dibromo-2-methylquinazolin-4-one.
What is the SMILES notation for 3-amino-6,8-dibromo-2-methylquinazolin-4-one?
The canonical SMILES for 3-amino-6,8-dibromo-2-methylquinazolin-4-one is Cc1nc2c(Br)cc(Br)cc2c(=O)n1N.
What is the InChIKey of 3-amino-6,8-dibromo-2-methylquinazolin-4-one?
The InChIKey is UHTFEUZQHUMEIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Br2N3O/c1-4-13-8-6(9(15)14(4)12)2-5(10)3-7(8)11/h2-3H,12H2,1H3.
What are the key properties of 3-amino-6,8-dibromo-2-methylquinazolin-4-one?
3-amino-6,8-dibromo-2-methylquinazolin-4-one has a molecular weight of 332.98 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,8-dibromo-2-methylquinazolin-4-one is sourced from PubChem (CID 13479537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).