About 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one
1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one (PubChem CID 134795547) has the molecular formula C21H25N3O
and a molecular weight of 335.45 g/mol. Its IUPAC name is 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one |
| PubChem CID | 134795547 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one |
| SMILES | CN(C)c1ccc(CN2CCC3(Cc4ccccc4NC3=O)C2)cc1 |
| InChI | InChI=1S/C21H25N3O/c1-23(2)18-9-7-16(8-10-18)14-24-12-11-21(15-24)13-17-5-3-4-6-19(17)22-20(21)25/h3-10H,11-15H2,1-2H3,(H,22,25) |
| InChIKey | HBJVMQKYJPOUND-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one?
The IUPAC name of 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one (CID 134795547) is 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one.
What is the SMILES notation for 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one?
The canonical SMILES for 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one is CN(C)c1ccc(CN2CCC3(Cc4ccccc4NC3=O)C2)cc1.
What is the InChIKey of 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one?
The InChIKey is HBJVMQKYJPOUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O/c1-23(2)18-9-7-16(8-10-18)14-24-12-11-21(15-24)13-17-5-3-4-6-19(17)22-20(21)25/h3-10H,11-15H2,1-2H3,(H,22,25).
What are the key properties of 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one?
1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one has a molecular weight of 335.45 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[[4-(dimethylamino)phenyl]methyl]spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one is sourced from PubChem (CID 134795547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).