C20H22N6O3 — CID 134795684
7-[[4-(dimethylamino)phenyl]methyl]-2-(4-nitrophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 134795684) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 7-[[4-(dimethylamino)phenyl]methyl]-2-(4-nitrophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 7-[[4-(dimethylamino)phenyl]methyl]-2-(4-nitrophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 134795684 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 7-[[4-(dimethylamino)phenyl]methyl]-2-(4-nitrophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | CN(C)c1ccc(CN2CCn3c(nn(-c4ccc([N+](=O)[O-])cc4)c3=O)C2)cc1 |
| InChI | InChI=1S/C20H22N6O3/c1-22(2)16-5-3-15(4-6-16)13-23-11-12-24-19(14-23)21-25(20(24)27)17-7-9-18(10-8-17)26(28)29/h3-10H,11-14H2,1-2H3 |
| InChIKey | JTHBZMCDMMCELE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|