About N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide
N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 134795846) has the molecular formula C18H14N4OS
and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide.
Molecular Properties
| Compound Name | N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
| PubChem CID | 134795846 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nc3sccn3c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C18H14N4OS/c1-12-2-4-14(5-3-12)20-17(23)15-16(13-6-8-19-9-7-13)22-10-11-24-18(22)21-15/h2-11H,1H3,(H,20,23) |
| InChIKey | ZSBUSJPEWROYCE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide?
The IUPAC name of N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide (CID 134795846) is N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide.
What is the SMILES notation for N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide?
The canonical SMILES for N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide is Cc1ccc(NC(=O)c2nc3sccn3c2-c2ccncc2)cc1.
What is the InChIKey of N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide?
The InChIKey is ZSBUSJPEWROYCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4OS/c1-12-2-4-14(5-3-12)20-17(23)15-16(13-6-8-19-9-7-13)22-10-11-24-18(22)21-15/h2-11H,1H3,(H,20,23).
What are the key properties of N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide?
N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide has a molecular weight of 334.40 g/mol, XLogP of 4.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylphenyl)-5-pyridin-4-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide is sourced from PubChem (CID 134795846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).