About N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide
N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 134796092) has the molecular formula C20H16FN3O2S
and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide.
Molecular Properties
| Compound Name | N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| PubChem CID | 134796092 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | COc1cccc(-c2c(C(=O)NCc3ccc(F)cc3)nc3sccn23)c1 |
| InChI | InChI=1S/C20H16FN3O2S/c1-26-16-4-2-3-14(11-16)18-17(23-20-24(18)9-10-27-20)19(25)22-12-13-5-7-15(21)8-6-13/h2-11H,12H2,1H3,(H,22,25) |
| InChIKey | BGERBQQKOGOLCV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide?
The IUPAC name of N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide (CID 134796092) is N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide.
What is the SMILES notation for N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide?
The canonical SMILES for N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide is COc1cccc(-c2c(C(=O)NCc3ccc(F)cc3)nc3sccn23)c1.
What is the InChIKey of N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide?
The InChIKey is BGERBQQKOGOLCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FN3O2S/c1-26-16-4-2-3-14(11-16)18-17(23-20-24(18)9-10-27-20)19(25)22-12-13-5-7-15(21)8-6-13/h2-11H,12H2,1H3,(H,22,25).
What are the key properties of N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide?
N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide has a molecular weight of 381.43 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-fluorophenyl)methyl]-5-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide is sourced from PubChem (CID 134796092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).