C18H18F3N5O2S — CID 134796185
CID 134796185 (PubChem CID 134796185) has the molecular formula C18H18F3N5O2S and a molecular weight of 425.44 g/mol.
| Compound Name | CID 134796185 |
|---|---|
| PubChem CID | 134796185 |
| Molecular Formula | C18H18F3N5O2S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(NC1CCN(c2ccnc3ccnn23)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3N5O2S/c19-18(20,21)13-2-1-3-15(12-13)29(27,28)24-14-6-10-25(11-7-14)17-5-8-22-16-4-9-23-26(16)17/h1-5,8-9,12,14H,6-7,10-11H2,(H-,24,27,28) |
| InChIKey | UYZOLTBEVXULBC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|