About N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide
N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 134796735) has the molecular formula C24H28F2N2O
and a molecular weight of 398.50 g/mol. Its IUPAC name is N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide |
| PubChem CID | 134796735 |
| Molecular Formula | C24H28F2N2O |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCC1)C1CCCN(Cc2cccc(-c3ccc(F)cc3F)c2)C1 |
| InChI | InChI=1S/C24H28F2N2O/c25-20-10-11-22(23(26)14-20)18-6-3-5-17(13-18)15-28-12-4-7-19(16-28)24(29)27-21-8-1-2-9-21/h3,5-6,10-11,13-14,19,21H,1-2,4,7-9,12,15-16H2,(H,27,29) |
| InChIKey | OJXPGFXIQRGFMH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide?
The IUPAC name of N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide (CID 134796735) is N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide.
What is the SMILES notation for N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide?
The canonical SMILES for N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide is O=C(NC1CCCC1)C1CCCN(Cc2cccc(-c3ccc(F)cc3F)c2)C1.
What is the InChIKey of N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide?
The InChIKey is OJXPGFXIQRGFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28F2N2O/c25-20-10-11-22(23(26)14-20)18-6-3-5-17(13-18)15-28-12-4-7-19(16-28)24(29)27-21-8-1-2-9-21/h3,5-6,10-11,13-14,19,21H,1-2,4,7-9,12,15-16H2,(H,27,29).
What are the key properties of N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide?
N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide has a molecular weight of 398.50 g/mol, XLogP of 4.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1-[[3-(2,4-difluorophenyl)phenyl]methyl]piperidine-3-carboxamide is sourced from PubChem (CID 134796735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).