C22H23ClN6O2 — CID 134796920
[1-(6-chloropyridine-3-carbonyl)pyrrolidin-3-yl]-[4-(1H-imidazo[4,5-b]pyridin-2-yl)piperidin-1-yl]methanone (PubChem CID 134796920) has the molecular formula C22H23ClN6O2 and a molecular weight of 438.92 g/mol. Its IUPAC name is [1-(6-chloropyridine-3-carbonyl)pyrrolidin-3-yl]-[4-(1H-imidazo[4,5-b]pyridin-2-yl)piperidin-1-yl]methanone.
| Compound Name | [1-(6-chloropyridine-3-carbonyl)pyrrolidin-3-yl]-[4-(1H-imidazo[4,5-b]pyridin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 134796920 |
| Molecular Formula | C22H23ClN6O2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [1-(6-chloropyridine-3-carbonyl)pyrrolidin-3-yl]-[4-(1H-imidazo[4,5-b]pyridin-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)nc1)N1CCC(C(=O)N2CCC(c3nc4ncccc4[nH]3)CC2)C1 |
| InChI | InChI=1S/C22H23ClN6O2/c23-18-4-3-15(12-25-18)21(30)29-11-7-16(13-29)22(31)28-9-5-14(6-10-28)19-26-17-2-1-8-24-20(17)27-19/h1-4,8,12,14,16H,5-7,9-11,13H2,(H,24,26,27) |
| InChIKey | AYECYHJWDYWBGW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|