About N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide
N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 134796973) has the molecular formula C20H20F3N3OS
and a molecular weight of 407.46 g/mol. Its IUPAC name is N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| PubChem CID | 134796973 |
| Molecular Formula | C20H20F3N3OS |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1nc2sccn2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3N3OS/c21-20(22,23)14-9-7-13(8-10-14)17-16(25-19-26(17)11-12-28-19)18(27)24-15-5-3-1-2-4-6-15/h7-12,15H,1-6H2,(H,24,27) |
| InChIKey | QMYRRIQVMBZIQJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide?
The IUPAC name of N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide (CID 134796973) is N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide.
What is the SMILES notation for N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide?
The canonical SMILES for N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide is O=C(NC1CCCCCC1)c1nc2sccn2c1-c1ccc(C(F)(F)F)cc1.
What is the InChIKey of N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide?
The InChIKey is QMYRRIQVMBZIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3N3OS/c21-20(22,23)14-9-7-13(8-10-14)17-16(25-19-26(17)11-12-28-19)18(27)24-15-5-3-1-2-4-6-15/h7-12,15H,1-6H2,(H,24,27).
What are the key properties of N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide?
N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide has a molecular weight of 407.46 g/mol, XLogP of 5.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-5-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide is sourced from PubChem (CID 134796973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).