About 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one
4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one (PubChem CID 134797233) has the molecular formula C19H25N5O4
and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 134797233 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one |
| SMILES | CCCCn1c(=O)c(C(=O)N2CCN(C(=O)COC)CC2)nc2cccnc21 |
| InChI | InChI=1S/C19H25N5O4/c1-3-4-8-24-17-14(6-5-7-20-17)21-16(19(24)27)18(26)23-11-9-22(10-12-23)15(25)13-28-2/h5-7H,3-4,8-13H2,1-2H3 |
| InChIKey | OEAMQAZSCHNMMJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one (CID 134797233) is 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one is CCCCn1c(=O)c(C(=O)N2CCN(C(=O)COC)CC2)nc2cccnc21.
What is the InChIKey of 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one?
The InChIKey is OEAMQAZSCHNMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O4/c1-3-4-8-24-17-14(6-5-7-20-17)21-16(19(24)27)18(26)23-11-9-22(10-12-23)15(25)13-28-2/h5-7H,3-4,8-13H2,1-2H3.
What are the key properties of 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one?
4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one has a molecular weight of 387.44 g/mol, XLogP of 0.52, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 134797233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).