About cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone
cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone (PubChem CID 134797317) has the molecular formula C15H19N5O
and a molecular weight of 285.35 g/mol. Its IUPAC name is cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone.
Molecular Properties
| Compound Name | cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone |
| PubChem CID | 134797317 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone |
| SMILES | O=C(C1CC1)N1CCCN(c2ccnc3ccnn23)CC1 |
| InChI | InChI=1S/C15H19N5O/c21-15(12-2-3-12)19-9-1-8-18(10-11-19)14-5-6-16-13-4-7-17-20(13)14/h4-7,12H,1-3,8-11H2 |
| InChIKey | VROGXADFJYGXBG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone?
The IUPAC name of cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone (CID 134797317) is cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone.
What is the SMILES notation for cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone?
The canonical SMILES for cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone is O=C(C1CC1)N1CCCN(c2ccnc3ccnn23)CC1.
What is the InChIKey of cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone?
The InChIKey is VROGXADFJYGXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O/c21-15(12-2-3-12)19-9-1-8-18(10-11-19)14-5-6-16-13-4-7-17-20(13)14/h4-7,12H,1-3,8-11H2.
What are the key properties of cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone?
cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone has a molecular weight of 285.35 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(4-pyrazolo[1,5-a]pyrimidin-7-yl-1,4-diazepan-1-yl)methanone is sourced from PubChem (CID 134797317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).