About methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate
methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate (PubChem CID 134797332) has the molecular formula C23H28N2O3
and a molecular weight of 380.49 g/mol. Its IUPAC name is methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate |
| PubChem CID | 134797332 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C1CCCN1Cc1ccc(-c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-16-11-17(2)13-20(12-16)19-8-6-18(7-9-19)15-25-10-4-5-21(25)23(27)24-14-22(26)28-3/h6-9,11-13,21H,4-5,10,14-15H2,1-3H3,(H,24,27) |
| InChIKey | HPTBYWHMDPKOGH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate?
The IUPAC name of methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate (CID 134797332) is methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate.
What is the SMILES notation for methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate?
The canonical SMILES for methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate is COC(=O)CNC(=O)C1CCCN1Cc1ccc(-c2cc(C)cc(C)c2)cc1.
What is the InChIKey of methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate?
The InChIKey is HPTBYWHMDPKOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O3/c1-16-11-17(2)13-20(12-16)19-8-6-18(7-9-19)15-25-10-4-5-21(25)23(27)24-14-22(26)28-3/h6-9,11-13,21H,4-5,10,14-15H2,1-3H3,(H,24,27).
What are the key properties of methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate?
methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate has a molecular weight of 380.49 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]pyrrolidine-2-carbonyl]amino]acetate is sourced from PubChem (CID 134797332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).