C18H17F3N4O3 — CID 134797822
N-(3-methoxypropyl)-3-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 134797822) has the molecular formula C18H17F3N4O3 and a molecular weight of 394.35 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-(3-methoxypropyl)-3-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 134797822 |
| Molecular Formula | C18H17F3N4O3 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-(3-methoxypropyl)-3-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | COCCCNC(=O)c1ccc2nnc(-c3ccc(OC(F)(F)F)cc3)n2c1 |
| InChI | InChI=1S/C18H17F3N4O3/c1-27-10-2-9-22-17(26)13-5-8-15-23-24-16(25(15)11-13)12-3-6-14(7-4-12)28-18(19,20)21/h3-8,11H,2,9-10H2,1H3,(H,22,26) |
| InChIKey | UUDQSAKYFFLEPR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|