C24H30ClN3O — CID 134798200
4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]-N-cyclopentylpiperazine-1-carboxamide (PubChem CID 134798200) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is 4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]-N-cyclopentylpiperazine-1-carboxamide.
| Compound Name | 4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]-N-cyclopentylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 134798200 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]-N-cyclopentylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(-c2ccccc2CN2CCN(C(=O)NC3CCCC3)CC2)cc1Cl |
| InChI | InChI=1S/C24H30ClN3O/c1-18-10-11-19(16-23(18)25)22-9-5-2-6-20(22)17-27-12-14-28(15-13-27)24(29)26-21-7-3-4-8-21/h2,5-6,9-11,16,21H,3-4,7-8,12-15,17H2,1H3,(H,26,29) |
| InChIKey | BYHGHMQZOXSYBH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |