About (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone
(4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone (PubChem CID 134799089) has the molecular formula C16H17N5OS
and a molecular weight of 327.41 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone.
Molecular Properties
| Compound Name | (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone |
| PubChem CID | 134799089 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone |
| SMILES | CN1CCN(C(=O)c2nc3sccn3c2-c2ccncc2)CC1 |
| InChI | InChI=1S/C16H17N5OS/c1-19-6-8-20(9-7-19)15(22)13-14(12-2-4-17-5-3-12)21-10-11-23-16(21)18-13/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | PWCLFNTZGUNKJL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone?
The IUPAC name of (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone (CID 134799089) is (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone.
What is the SMILES notation for (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone?
The canonical SMILES for (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone is CN1CCN(C(=O)c2nc3sccn3c2-c2ccncc2)CC1.
What is the InChIKey of (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone?
The InChIKey is PWCLFNTZGUNKJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5OS/c1-19-6-8-20(9-7-19)15(22)13-14(12-2-4-17-5-3-12)21-10-11-23-16(21)18-13/h2-5,10-11H,6-9H2,1H3.
What are the key properties of (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone?
(4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone has a molecular weight of 327.41 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylpiperazin-1-yl)-(5-pyridin-4-ylimidazo[2,1-b][1,3]thiazol-6-yl)methanone is sourced from PubChem (CID 134799089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).