About 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one
2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one (PubChem CID 134799153) has the molecular formula C19H25N5O5
and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 134799153 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one |
| SMILES | COCCCn1c(=O)c(C(=O)N2CCN(C(=O)COC)CC2)nc2cccnc21 |
| InChI | InChI=1S/C19H25N5O5/c1-28-12-4-7-24-17-14(5-3-6-20-17)21-16(19(24)27)18(26)23-10-8-22(9-11-23)15(25)13-29-2/h3,5-6H,4,7-13H2,1-2H3 |
| InChIKey | XRBRBUIPQVSDSL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 106.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one (CID 134799153) is 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one is COCCCn1c(=O)c(C(=O)N2CCN(C(=O)COC)CC2)nc2cccnc21.
What is the InChIKey of 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one?
The InChIKey is XRBRBUIPQVSDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O5/c1-28-12-4-7-24-17-14(5-3-6-20-17)21-16(19(24)27)18(26)23-10-8-22(9-11-23)15(25)13-29-2/h3,5-6H,4,7-13H2,1-2H3.
What are the key properties of 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one?
2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one has a molecular weight of 403.44 g/mol, XLogP of -0.24, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-methoxyacetyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 134799153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).