C22H28FN3O3 — CID 134799253
1-[1-[1-(2-fluorobenzoyl)piperidine-3-carbonyl]piperidin-4-yl]pyrrolidin-2-one (PubChem CID 134799253) has the molecular formula C22H28FN3O3 and a molecular weight of 401.48 g/mol. Its IUPAC name is 1-[1-[1-(2-fluorobenzoyl)piperidine-3-carbonyl]piperidin-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[1-[1-(2-fluorobenzoyl)piperidine-3-carbonyl]piperidin-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134799253 |
| Molecular Formula | C22H28FN3O3 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-[1-[1-(2-fluorobenzoyl)piperidine-3-carbonyl]piperidin-4-yl]pyrrolidin-2-one |
| SMILES | O=C(c1ccccc1F)N1CCCC(C(=O)N2CCC(N3CCCC3=O)CC2)C1 |
| InChI | InChI=1S/C22H28FN3O3/c23-19-7-2-1-6-18(19)22(29)25-11-3-5-16(15-25)21(28)24-13-9-17(10-14-24)26-12-4-8-20(26)27/h1-2,6-7,16-17H,3-5,8-15H2 |
| InChIKey | XVMMIAHOQZKBEC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |