About 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide
1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 134799375) has the molecular formula C17H19N5OS
and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| PubChem CID | 134799375 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)C1CCCN(c2ccnc3ccnn23)C1 |
| InChI | InChI=1S/C17H19N5OS/c23-17(19-11-14-4-2-10-24-14)13-3-1-9-21(12-13)16-6-7-18-15-5-8-20-22(15)16/h2,4-8,10,13H,1,3,9,11-12H2,(H,19,23) |
| InChIKey | MAAFCENPFQLHHU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide?
The IUPAC name of 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide (CID 134799375) is 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide.
What is the SMILES notation for 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide?
The canonical SMILES for 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide is O=C(NCc1cccs1)C1CCCN(c2ccnc3ccnn23)C1.
What is the InChIKey of 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide?
The InChIKey is MAAFCENPFQLHHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5OS/c23-17(19-11-14-4-2-10-24-14)13-3-1-9-21(12-13)16-6-7-18-15-5-8-20-22(15)16/h2,4-8,10,13H,1,3,9,11-12H2,(H,19,23).
What are the key properties of 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide?
1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide has a molecular weight of 341.44 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazolo[1,5-a]pyrimidin-7-yl-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide is sourced from PubChem (CID 134799375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).