C18H16F3N5O2 — CID 134799826
4-[4-(dimethylamino)phenyl]-3-oxo-N-(2,2,2-trifluoroethyl)pyrido[2,3-b]pyrazine-2-carboxamide (PubChem CID 134799826) has the molecular formula C18H16F3N5O2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-3-oxo-N-(2,2,2-trifluoroethyl)pyrido[2,3-b]pyrazine-2-carboxamide.
| Compound Name | 4-[4-(dimethylamino)phenyl]-3-oxo-N-(2,2,2-trifluoroethyl)pyrido[2,3-b]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 134799826 |
| Molecular Formula | C18H16F3N5O2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-3-oxo-N-(2,2,2-trifluoroethyl)pyrido[2,3-b]pyrazine-2-carboxamide |
| SMILES | CN(C)c1ccc(-n2c(=O)c(C(=O)NCC(F)(F)F)nc3cccnc32)cc1 |
| InChI | InChI=1S/C18H16F3N5O2/c1-25(2)11-5-7-12(8-6-11)26-15-13(4-3-9-22-15)24-14(17(26)28)16(27)23-10-18(19,20)21/h3-9H,10H2,1-2H3,(H,23,27) |
| InChIKey | MRXKJMWBPKRJCI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|