C22H18F3N3OS — CID 134800085
N-(3-phenylpropyl)-5-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 134800085) has the molecular formula C22H18F3N3OS and a molecular weight of 429.47 g/mol. Its IUPAC name is N-(3-phenylpropyl)-5-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-(3-phenylpropyl)-5-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 134800085 |
| Molecular Formula | C22H18F3N3OS |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-(3-phenylpropyl)-5-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1nc2sccn2c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F3N3OS/c23-22(24,25)17-10-4-9-16(14-17)19-18(27-21-28(19)12-13-30-21)20(29)26-11-5-8-15-6-2-1-3-7-15/h1-4,6-7,9-10,12-14H,5,8,11H2,(H,26,29) |
| InChIKey | LECDSPOUYAFPRG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|