C24H26FN5O — CID 134800310
1-[4-(2-fluoroanilino)pyrimidin-2-yl]-N-(3-phenylpropyl)pyrrolidine-2-carboxamide (PubChem CID 134800310) has the molecular formula C24H26FN5O and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[4-(2-fluoroanilino)pyrimidin-2-yl]-N-(3-phenylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[4-(2-fluoroanilino)pyrimidin-2-yl]-N-(3-phenylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134800310 |
| Molecular Formula | C24H26FN5O |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-[4-(2-fluoroanilino)pyrimidin-2-yl]-N-(3-phenylpropyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCCN1c1nccc(Nc2ccccc2F)n1 |
| InChI | InChI=1S/C24H26FN5O/c25-19-11-4-5-12-20(19)28-22-14-16-27-24(29-22)30-17-7-13-21(30)23(31)26-15-6-10-18-8-2-1-3-9-18/h1-5,8-9,11-12,14,16,21H,6-7,10,13,15,17H2,(H,26,31)(H,27,28,29) |
| InChIKey | NWXDSKIVPAZYMO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|