About N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide
N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide (PubChem CID 134800813) has the molecular formula C21H24F2N2O2
and a molecular weight of 374.43 g/mol. Its IUPAC name is N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide.
Molecular Properties
| Compound Name | N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide |
| PubChem CID | 134800813 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC1CCN(Cc2cccc(-c3ccc(F)c(F)c3)c2)CC1 |
| InChI | InChI=1S/C21H24F2N2O2/c1-27-14-21(26)24-18-7-9-25(10-8-18)13-15-3-2-4-16(11-15)17-5-6-19(22)20(23)12-17/h2-6,11-12,18H,7-10,13-14H2,1H3,(H,24,26) |
| InChIKey | LDCKFUOTGWVRLY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide?
The IUPAC name of N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide (CID 134800813) is N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide.
What is the SMILES notation for N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide?
The canonical SMILES for N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide is COCC(=O)NC1CCN(Cc2cccc(-c3ccc(F)c(F)c3)c2)CC1.
What is the InChIKey of N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide?
The InChIKey is LDCKFUOTGWVRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2N2O2/c1-27-14-21(26)24-18-7-9-25(10-8-18)13-15-3-2-4-16(11-15)17-5-6-19(22)20(23)12-17/h2-6,11-12,18H,7-10,13-14H2,1H3,(H,24,26).
What are the key properties of N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide?
N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide has a molecular weight of 374.43 g/mol, XLogP of 3.36, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[[3-(3,4-difluorophenyl)phenyl]methyl]piperidin-4-yl]-2-methoxyacetamide is sourced from PubChem (CID 134800813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).