C24H26N4O3S — CID 134801399
CID 134801399 (PubChem CID 134801399) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol.
| Compound Name | CID 134801399 |
|---|---|
| PubChem CID | 134801399 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | — |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(C(C)C)N(C1CN([S+](=O)([O-])c3ccccc3)C1)C2=O |
| InChI | InChI=1S/C24H26N4O3S/c1-16(2)22-21-17(3)25-28(18-10-6-4-7-11-18)23(21)24(29)27(22)19-14-26(15-19)32(30,31)20-12-8-5-9-13-20/h4-13,16,19,22H,14-15H2,1-3H3 |
| InChIKey | JOSDIFAXAQRTKE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|