C27H29FN2O2 — CID 134801433
N-benzyl-1-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]piperidine-2-carboxamide (PubChem CID 134801433) has the molecular formula C27H29FN2O2 and a molecular weight of 432.54 g/mol. Its IUPAC name is N-benzyl-1-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]piperidine-2-carboxamide.
| Compound Name | N-benzyl-1-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 134801433 |
| Molecular Formula | C27H29FN2O2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-benzyl-1-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]piperidine-2-carboxamide |
| SMILES | COc1ccc(F)cc1-c1ccc(CN2CCCCC2C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29FN2O2/c1-32-26-15-14-23(28)17-24(26)22-12-10-21(11-13-22)19-30-16-6-5-9-25(30)27(31)29-18-20-7-3-2-4-8-20/h2-4,7-8,10-15,17,25H,5-6,9,16,18-19H2,1H3,(H,29,31) |
| InChIKey | LSXXWYSWNZYBAM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |