About CID 134801572
CID 134801572 (PubChem CID 134801572) has the molecular formula C25H29N5O4S
and a molecular weight of 495.61 g/mol.
Molecular Properties
| Compound Name | CID 134801572 |
| PubChem CID | 134801572 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | — |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(C1CC1)N(C1CCCN([S+](=O)([O-])c3c(C)noc3C)C1)C2=O |
| InChI | InChI=1S/C25H29N5O4S/c1-15-21-22(18-11-12-18)29(25(31)23(21)30(26-15)19-8-5-4-6-9-19)20-10-7-13-28(14-20)35(32,33)24-16(2)27-34-17(24)3/h4-6,8-9,18,20,22H,7,10-14H2,1-3H3 |
| InChIKey | XWSXGKQMBLDKNM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 107.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134801572 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134801572?
The IUPAC name of CID 134801572 (CID 134801572) is not available.
What is the SMILES notation for CID 134801572?
The canonical SMILES for CID 134801572 is Cc1nn(-c2ccccc2)c2c1C(C1CC1)N(C1CCCN([S+](=O)([O-])c3c(C)noc3C)C1)C2=O.
What is the InChIKey of CID 134801572?
The InChIKey is XWSXGKQMBLDKNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N5O4S/c1-15-21-22(18-11-12-18)29(25(31)23(21)30(26-15)19-8-5-4-6-9-19)20-10-7-13-28(14-20)35(32,33)24-16(2)27-34-17(24)3/h4-6,8-9,18,20,22H,7,10-14H2,1-3H3.
What are the key properties of CID 134801572?
CID 134801572 has a molecular weight of 495.61 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134801572 is sourced from PubChem (CID 134801572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).