C23H21F3N6O2S — CID 134801955
CID 134801955 (PubChem CID 134801955) has the molecular formula C23H21F3N6O2S and a molecular weight of 502.52 g/mol.
| Compound Name | CID 134801955 |
|---|---|
| PubChem CID | 134801955 |
| Molecular Formula | C23H21F3N6O2S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(c1cccc(C(F)(F)F)c1)N1CCCN(c2ccc3nnc(-c4ccccc4)n3n2)CC1 |
| InChI | InChI=1S/C23H21F3N6O2S/c24-23(25,26)18-8-4-9-19(16-18)35(33,34)31-13-5-12-30(14-15-31)21-11-10-20-27-28-22(32(20)29-21)17-6-2-1-3-7-17/h1-4,6-11,16H,5,12-15H2 |
| InChIKey | DVVGWZKAWOTOIW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|