C19H22N4O4S — CID 134802150
CID 134802150 (PubChem CID 134802150) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol.
| Compound Name | CID 134802150 |
|---|---|
| PubChem CID | 134802150 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | — |
| SMILES | COc1ccccc1C(=O)N1CCCC2(CN[S+](=O)([O-])c3cccnc3N2)C1 |
| InChI | InChI=1S/C19H22N4O4S/c1-27-15-7-3-2-6-14(15)18(24)23-11-5-9-19(13-23)12-21-28(25,26)16-8-4-10-20-17(16)22-19/h2-4,6-8,10H,5,9,11-13H2,1H3,(H2-,20,21,22,25,26) |
| InChIKey | BUJBUTWAURYNHU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|