C24H24ClN5O2 — CID 134802214
5-[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-3,4-dimethyl-1-phenyl-4H-pyrrolo[3,4-d]pyrazol-6-one (PubChem CID 134802214) has the molecular formula C24H24ClN5O2 and a molecular weight of 449.94 g/mol. Its IUPAC name is 5-[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-3,4-dimethyl-1-phenyl-4H-pyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 5-[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-3,4-dimethyl-1-phenyl-4H-pyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 134802214 |
| Molecular Formula | C24H24ClN5O2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 5-[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-3,4-dimethyl-1-phenyl-4H-pyrrolo[3,4-d]pyrazol-6-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(C)N(C1CCN(C(=O)c3ccc(Cl)nc3)CC1)C2=O |
| InChI | InChI=1S/C24H24ClN5O2/c1-15-21-16(2)29(24(32)22(21)30(27-15)19-6-4-3-5-7-19)18-10-12-28(13-11-18)23(31)17-8-9-20(25)26-14-17/h3-9,14,16,18H,10-13H2,1-2H3 |
| InChIKey | VBLNAMKLXLKNGY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|