C23H24N4O — CID 134802336
N-phenyl-4-[(2-pyridin-3-ylphenyl)methyl]piperazine-1-carboxamide (PubChem CID 134802336) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is N-phenyl-4-[(2-pyridin-3-ylphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-phenyl-4-[(2-pyridin-3-ylphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 134802336 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-phenyl-4-[(2-pyridin-3-ylphenyl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCN(Cc2ccccc2-c2cccnc2)CC1 |
| InChI | InChI=1S/C23H24N4O/c28-23(25-21-9-2-1-3-10-21)27-15-13-26(14-16-27)18-20-7-4-5-11-22(20)19-8-6-12-24-17-19/h1-12,17H,13-16,18H2,(H,25,28) |
| InChIKey | COVGVWSFJSBCQW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |