C22H22N2O3S2 — CID 134802505
CID 134802505 (PubChem CID 134802505) has the molecular formula C22H22N2O3S2 and a molecular weight of 426.56 g/mol.
| Compound Name | CID 134802505 |
|---|---|
| PubChem CID | 134802505 |
| Molecular Formula | C22H22N2O3S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc(-c2cccs2)cc1)N1CCC(N[S+](=O)([O-])c2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N2O3S2/c25-22(18-10-8-17(9-11-18)21-7-4-16-28-21)24-14-12-19(13-15-24)23-29(26,27)20-5-2-1-3-6-20/h1-11,16,19H,12-15H2,(H-,23,26,27) |
| InChIKey | OKCMSMRCPPOHGI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|