C18H29N5O2 — CID 134802754
2-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 134802754) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 134802754 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=C(C1CCCC1)N1CCN(CCn2nc3n(c2=O)CCCC3)CC1 |
| InChI | InChI=1S/C18H29N5O2/c24-17(15-5-1-2-6-15)21-12-9-20(10-13-21)11-14-23-18(25)22-8-4-3-7-16(22)19-23/h15H,1-14H2 |
| InChIKey | DMMKGBBXZDVXQQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |