About N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide
N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 134802887) has the molecular formula C23H22N4O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
| PubChem CID | 134802887 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)N(C)Cc2ccccc2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C23H22N4O2/c1-26(15-16-9-5-4-6-10-16)23(28)18-13-20(17-11-7-8-12-21(17)29-3)25-22-19(18)14-24-27(22)2/h4-14H,15H2,1-3H3 |
| InChIKey | RZYWNTXBURZTOC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide?
The IUPAC name of N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide (CID 134802887) is N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide.
What is the SMILES notation for N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide?
The canonical SMILES for N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide is COc1ccccc1-c1cc(C(=O)N(C)Cc2ccccc2)c2cnn(C)c2n1.
What is the InChIKey of N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide?
The InChIKey is RZYWNTXBURZTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O2/c1-26(15-16-9-5-4-6-10-16)23(28)18-13-20(17-11-7-8-12-21(17)29-3)25-22-19(18)14-24-27(22)2/h4-14H,15H2,1-3H3.
What are the key properties of N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide?
N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide has a molecular weight of 386.46 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-6-(2-methoxyphenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide is sourced from PubChem (CID 134802887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).