About N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide
N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide (PubChem CID 134803198) has the molecular formula C23H30N2O2
and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide.
Molecular Properties
| Compound Name | N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide |
| PubChem CID | 134803198 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC1CCCN(Cc2ccc(-c3cc(C)cc(C)c3)cc2)C1 |
| InChI | InChI=1S/C23H30N2O2/c1-17-11-18(2)13-21(12-17)20-8-6-19(7-9-20)14-25-10-4-5-22(15-25)24-23(26)16-27-3/h6-9,11-13,22H,4-5,10,14-16H2,1-3H3,(H,24,26) |
| InChIKey | XSWDCNQVXBERSG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide?
The IUPAC name of N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide (CID 134803198) is N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide.
What is the SMILES notation for N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide?
The canonical SMILES for N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide is COCC(=O)NC1CCCN(Cc2ccc(-c3cc(C)cc(C)c3)cc2)C1.
What is the InChIKey of N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide?
The InChIKey is XSWDCNQVXBERSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O2/c1-17-11-18(2)13-21(12-17)20-8-6-19(7-9-20)14-25-10-4-5-22(15-25)24-23(26)16-27-3/h6-9,11-13,22H,4-5,10,14-16H2,1-3H3,(H,24,26).
What are the key properties of N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide?
N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide has a molecular weight of 366.51 g/mol, XLogP of 3.70, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]-2-methoxyacetamide is sourced from PubChem (CID 134803198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).